C12H17N3O3S — CID 76953193
3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N'-hydroxypropanimidamide (PubChem CID 76953193) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76953193 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N'-hydroxypropanimidamide |
| SMILES | NC(CCNS(=O)(=O)c1ccc2c(c1)CCC2)=NO |
| InChI | InChI=1S/C12H17N3O3S/c13-12(15-16)6-7-14-19(17,18)11-5-4-9-2-1-3-10(9)8-11/h4-5,8,14,16H,1-3,6-7H2,(H2,13,15) |
| InChIKey | IXDXUKSLNDJUDD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|