C17H22N2O6S2 — CID 51593029
N-[2-[(2R)-2-methylpiperidin-1-yl]sulfonylethyl]-2-oxochromene-6-sulfonamide (PubChem CID 51593029) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[2-[(2R)-2-methylpiperidin-1-yl]sulfonylethyl]-2-oxochromene-6-sulfonamide.
| Compound Name | N-[2-[(2R)-2-methylpiperidin-1-yl]sulfonylethyl]-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 51593029 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[2-[(2R)-2-methylpiperidin-1-yl]sulfonylethyl]-2-oxochromene-6-sulfonamide |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)CCNS(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C17H22N2O6S2/c1-13-4-2-3-10-19(13)26(21,22)11-9-18-27(23,24)15-6-7-16-14(12-15)5-8-17(20)25-16/h5-8,12-13,18H,2-4,9-11H2,1H3/t13-/m1/s1 |
| InChIKey | AGCJVWPYQBXNPB-CYBMUJFWSA-N |
| XLogP | 1.28 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|