C19H19NO4S — CID 24677933
2-oxo-N-(4-phenylbutyl)chromene-6-sulfonamide (PubChem CID 24677933) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-oxo-N-(4-phenylbutyl)chromene-6-sulfonamide.
| Compound Name | 2-oxo-N-(4-phenylbutyl)chromene-6-sulfonamide |
|---|---|
| PubChem CID | 24677933 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-oxo-N-(4-phenylbutyl)chromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)NCCCCc3ccccc3)ccc2o1 |
| InChI | InChI=1S/C19H19NO4S/c21-19-12-9-16-14-17(10-11-18(16)24-19)25(22,23)20-13-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-12,14,20H,4-5,8,13H2 |
| InChIKey | KRPCANLDVRDJBC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|