C13H17ClN2O4S — CID 119973429
N-[2-(ethylamino)ethyl]-2-oxochromene-6-sulfonamide;hydrochloride (PubChem CID 119973429) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-oxochromene-6-sulfonamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-oxochromene-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973429 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-oxochromene-6-sulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1ccc2oc(=O)ccc2c1.Cl |
| InChI | InChI=1S/C13H16N2O4S.ClH/c1-2-14-7-8-15-20(17,18)11-4-5-12-10(9-11)3-6-13(16)19-12;/h3-6,9,14-15H,2,7-8H2,1H3;1H |
| InChIKey | WIBKQNCZZALNAX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|