C13H14N2O5S — CID 134002341
N-[2-[(2-oxochromen-6-yl)sulfonylamino]ethyl]acetamide (PubChem CID 134002341) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-[2-[(2-oxochromen-6-yl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(2-oxochromen-6-yl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 134002341 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[2-[(2-oxochromen-6-yl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C13H14N2O5S/c1-9(16)14-6-7-15-21(18,19)11-3-4-12-10(8-11)2-5-13(17)20-12/h2-5,8,15H,6-7H2,1H3,(H,14,16) |
| InChIKey | OPFSOGRGNATAQS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|