C15H18N2O5S — CID 134002352
3-methyl-2-[(2-oxochromen-6-yl)sulfonylamino]pentanamide (PubChem CID 134002352) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-methyl-2-[(2-oxochromen-6-yl)sulfonylamino]pentanamide.
| Compound Name | 3-methyl-2-[(2-oxochromen-6-yl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 134002352 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-methyl-2-[(2-oxochromen-6-yl)sulfonylamino]pentanamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc2oc(=O)ccc2c1)C(N)=O |
| InChI | InChI=1S/C15H18N2O5S/c1-3-9(2)14(15(16)19)17-23(20,21)11-5-6-12-10(8-11)4-7-13(18)22-12/h4-9,14,17H,3H2,1-2H3,(H2,16,19) |
| InChIKey | UQEQECKRRJCEEN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|