C15H20N2O4S — CID 119992924
N-(1-aminohexan-2-yl)-2-oxochromene-6-sulfonamide (PubChem CID 119992924) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-oxochromene-6-sulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 119992924 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-oxochromene-6-sulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-2-3-4-12(10-16)17-22(19,20)13-6-7-14-11(9-13)5-8-15(18)21-14/h5-9,12,17H,2-4,10,16H2,1H3 |
| InChIKey | SVUCLBWPZRETFX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|