C17H22N2O5S2 — CID 55697459
3-N-[3-(1-phenylethoxy)propyl]benzene-1,3-disulfonamide (PubChem CID 55697459) has the molecular formula C17H22N2O5S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-N-[3-(1-phenylethoxy)propyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[3-(1-phenylethoxy)propyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55697459 |
| Molecular Formula | C17H22N2O5S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-N-[3-(1-phenylethoxy)propyl]benzene-1,3-disulfonamide |
| SMILES | CC(OCCCNS(=O)(=O)c1cccc(S(N)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O5S2/c1-14(15-7-3-2-4-8-15)24-12-6-11-19-26(22,23)17-10-5-9-16(13-17)25(18,20)21/h2-5,7-10,13-14,19H,6,11-12H2,1H3,(H2,18,20,21) |
| InChIKey | SICQSLFWPLFTHR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|