C15H26N2O3S — CID 43506942
N-(3-ethoxypropyl)-3-[1-(ethylamino)ethyl]benzenesulfonamide (PubChem CID 43506942) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-[1-(ethylamino)ethyl]benzenesulfonamide.
| Compound Name | N-(3-ethoxypropyl)-3-[1-(ethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43506942 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-(3-ethoxypropyl)-3-[1-(ethylamino)ethyl]benzenesulfonamide |
| SMILES | CCNC(C)c1cccc(S(=O)(=O)NCCCOCC)c1 |
| InChI | InChI=1S/C15H26N2O3S/c1-4-16-13(3)14-8-6-9-15(12-14)21(18,19)17-10-7-11-20-5-2/h6,8-9,12-13,16-17H,4-5,7,10-11H2,1-3H3 |
| InChIKey | VBGZREWUFBDIRG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|