C13H11ClN2O2S2 — CID 115588783
3-chloro-4-cyano-N-(2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 115588783) has the molecular formula C13H11ClN2O2S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115588783 |
| Molecular Formula | C13H11ClN2O2S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 3-chloro-4-cyano-N-(2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCc2ccsc2)cc1Cl |
| InChI | InChI=1S/C13H11ClN2O2S2/c14-13-7-12(2-1-11(13)8-15)20(17,18)16-5-3-10-4-6-19-9-10/h1-2,4,6-7,9,16H,3,5H2 |
| InChIKey | OQFQWKWQQDSBGD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |