C16H20N2O6 — CID 2564865
[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-methyl-3-nitrobenzoate (PubChem CID 2564865) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2564865 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OCC(=O)N2C[C@H](C)O[C@@H](C)C2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O6/c1-10-7-17(8-11(2)24-10)15(19)9-23-16(20)13-5-4-6-14(12(13)3)18(21)22/h4-6,10-11H,7-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | SUZKQHTZNOAAIE-QWRGUYRKSA-N |
| XLogP | 1.70 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|