C22H25NO4 — CID 9107081
[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 9107081) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-phenylmethoxybenzoate.
| Compound Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 9107081 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | C[C@H]1CCCN(C(=O)COC(=O)c2ccc(OCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H25NO4/c1-17-6-5-13-23(14-17)21(24)16-27-22(25)19-9-11-20(12-10-19)26-15-18-7-3-2-4-8-18/h2-4,7-12,17H,5-6,13-16H2,1H3/t17-/m0/s1 |
| InChIKey | ZICHAQODLFIVTJ-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |