C15H19N3O4 — CID 56807362
[2-(2-carbamoylpiperidin-1-yl)-2-oxoethyl] 6-methylpyridine-3-carboxylate (PubChem CID 56807362) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is [2-(2-carbamoylpiperidin-1-yl)-2-oxoethyl] 6-methylpyridine-3-carboxylate.
| Compound Name | [2-(2-carbamoylpiperidin-1-yl)-2-oxoethyl] 6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 56807362 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [2-(2-carbamoylpiperidin-1-yl)-2-oxoethyl] 6-methylpyridine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N2CCCCC2C(N)=O)cn1 |
| InChI | InChI=1S/C15H19N3O4/c1-10-5-6-11(8-17-10)15(21)22-9-13(19)18-7-3-2-4-12(18)14(16)20/h5-6,8,12H,2-4,7,9H2,1H3,(H2,16,20) |
| InChIKey | MZKSFLOYTANVRC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |