C18H22Cl2N2O4 — CID 9067618
[2-(2,4-dichloroanilino)-2-oxoethyl] 4-(cyclohexylamino)-4-oxobutanoate (PubChem CID 9067618) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 4-(cyclohexylamino)-4-oxobutanoate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 4-(cyclohexylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 9067618 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 4-(cyclohexylamino)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)NC1CCCCC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N2O4/c19-12-6-7-15(14(20)10-12)22-17(24)11-26-18(25)9-8-16(23)21-13-4-2-1-3-5-13/h6-7,10,13H,1-5,8-9,11H2,(H,21,23)(H,22,24) |
| InChIKey | KCTLPVSBXPBZRE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |