C16H17Cl2N3O4S — CID 67572284
4-[amino-[4-(2,4-dichlorophenoxy)butanoyl]amino]benzenesulfonamide (PubChem CID 67572284) has the molecular formula C16H17Cl2N3O4S and a molecular weight of 418.30 g/mol. Its IUPAC name is 4-[amino-[4-(2,4-dichlorophenoxy)butanoyl]amino]benzenesulfonamide.
| Compound Name | 4-[amino-[4-(2,4-dichlorophenoxy)butanoyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 67572284 |
| Molecular Formula | C16H17Cl2N3O4S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 4-[amino-[4-(2,4-dichlorophenoxy)butanoyl]amino]benzenesulfonamide |
| SMILES | NN(C(=O)CCCOc1ccc(Cl)cc1Cl)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H17Cl2N3O4S/c17-11-3-8-15(14(18)10-11)25-9-1-2-16(22)21(19)12-4-6-13(7-5-12)26(20,23)24/h3-8,10H,1-2,9,19H2,(H2,20,23,24) |
| InChIKey | DFEVNBVXUDQYBE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|