C18H25Cl2NO3 — CID 25144213
4-(2,4-dichlorophenoxy)-N-[4-(hydroxymethyl)cyclohexyl]-N-methylbutanamide (PubChem CID 25144213) has the molecular formula C18H25Cl2NO3 and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[4-(hydroxymethyl)cyclohexyl]-N-methylbutanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[4-(hydroxymethyl)cyclohexyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 25144213 |
| Molecular Formula | C18H25Cl2NO3 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[4-(hydroxymethyl)cyclohexyl]-N-methylbutanamide |
| SMILES | CN(C(=O)CCCOc1ccc(Cl)cc1Cl)C1CCC(CO)CC1 |
| InChI | InChI=1S/C18H25Cl2NO3/c1-21(15-7-4-13(12-22)5-8-15)18(23)3-2-10-24-17-9-6-14(19)11-16(17)20/h6,9,11,13,15,22H,2-5,7-8,10,12H2,1H3 |
| InChIKey | ZBLBIKQVWXDWMP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|