C19H25Cl2NO4 — CID 84559248
ethyl 3-[cyclopropyl-[4-(2,4-dichlorophenoxy)butanoyl]amino]-2-methylpropanoate (PubChem CID 84559248) has the molecular formula C19H25Cl2NO4 and a molecular weight of 402.32 g/mol. Its IUPAC name is ethyl 3-[cyclopropyl-[4-(2,4-dichlorophenoxy)butanoyl]amino]-2-methylpropanoate.
| Compound Name | ethyl 3-[cyclopropyl-[4-(2,4-dichlorophenoxy)butanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 84559248 |
| Molecular Formula | C19H25Cl2NO4 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | ethyl 3-[cyclopropyl-[4-(2,4-dichlorophenoxy)butanoyl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)CN(C(=O)CCCOc1ccc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C19H25Cl2NO4/c1-3-25-19(24)13(2)12-22(15-7-8-15)18(23)5-4-10-26-17-9-6-14(20)11-16(17)21/h6,9,11,13,15H,3-5,7-8,10,12H2,1-2H3 |
| InChIKey | XZRNKUWSLXTKDW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|