C19H24ClNO4 — CID 84558739
ethyl 3-[[4-(4-chlorophenyl)-4-oxobutanoyl]-cyclopropylamino]-2-methylpropanoate (PubChem CID 84558739) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is ethyl 3-[[4-(4-chlorophenyl)-4-oxobutanoyl]-cyclopropylamino]-2-methylpropanoate.
| Compound Name | ethyl 3-[[4-(4-chlorophenyl)-4-oxobutanoyl]-cyclopropylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 84558739 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethyl 3-[[4-(4-chlorophenyl)-4-oxobutanoyl]-cyclopropylamino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)CN(C(=O)CCC(=O)c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C19H24ClNO4/c1-3-25-19(24)13(2)12-21(16-8-9-16)18(23)11-10-17(22)14-4-6-15(20)7-5-14/h4-7,13,16H,3,8-12H2,1-2H3 |
| InChIKey | HJHSHBQRNFRUIR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |