C13H14Cl2N2O2 — CID 87018263
N-(2-cyanoethyl)-2-(2,4-dichlorophenoxy)-N-ethylacetamide (PubChem CID 87018263) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,4-dichlorophenoxy)-N-ethylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2,4-dichlorophenoxy)-N-ethylacetamide |
|---|---|
| PubChem CID | 87018263 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,4-dichlorophenoxy)-N-ethylacetamide |
| SMILES | CCN(CCC#N)C(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O2/c1-2-17(7-3-6-16)13(18)9-19-12-5-4-10(14)8-11(12)15/h4-5,8H,2-3,7,9H2,1H3 |
| InChIKey | VWUGVTKKZJDHKJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |