C17H22N4O2S — CID 54788365
N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-ethoxybenzamide (PubChem CID 54788365) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-ethoxybenzamide.
| Compound Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 54788365 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[4-(2-cyanoethyl)piperazine-1-carbothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)N2CCN(CCC#N)CC2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-23-15-6-4-14(5-7-15)16(22)19-17(24)21-12-10-20(11-13-21)9-3-8-18/h4-7H,2-3,9-13H2,1H3,(H,19,22,24) |
| InChIKey | MPCNLYXFEUSHRI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|