C19H21IN4OS — CID 17116403
4-iodo-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 17116403) has the molecular formula C19H21IN4OS and a molecular weight of 480.38 g/mol. Its IUPAC name is 4-iodo-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-iodo-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17116403 |
| Molecular Formula | C19H21IN4OS |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 4-iodo-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=S)NC(=O)c3ccc(I)cc3)cc2)CC1 |
| InChI | InChI=1S/C19H21IN4OS/c1-23-10-12-24(13-11-23)17-8-6-16(7-9-17)21-19(26)22-18(25)14-2-4-15(20)5-3-14/h2-9H,10-13H2,1H3,(H2,21,22,25,26) |
| InChIKey | NFXQFIUDWZWUCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|