C18H23N3OS — CID 110328814
2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 110328814) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110328814 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | Cc1nc(C)c(CC(=O)Nc2ccc(N3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C18H23N3OS/c1-13-17(23-14(2)19-13)12-18(22)20-15-6-8-16(9-7-15)21-10-4-3-5-11-21/h6-9H,3-5,10-12H2,1-2H3,(H,20,22) |
| InChIKey | WKCQWAVEMKYGQF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|