C21H24N4OS2 — CID 20995876
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 20995876) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 20995876 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-methyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1nc(-c2cccs2)c(CC(=O)Nc2ccc(N3CCN(C)CC3)cc2)s1 |
| InChI | InChI=1S/C21H24N4OS2/c1-15-22-21(18-4-3-13-27-18)19(28-15)14-20(26)23-16-5-7-17(8-6-16)25-11-9-24(2)10-12-25/h3-8,13H,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | ZWGUKSOLBMKIIG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|