C19H20N4OS2 — CID 4786757
N-(4-piperidin-1-ylphenyl)-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide (PubChem CID 4786757) has the molecular formula C19H20N4OS2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 4786757 |
| Molecular Formula | C19H20N4OS2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSc1ncnc2sccc12)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H20N4OS2/c24-17(12-26-19-16-8-11-25-18(16)20-13-21-19)22-14-4-6-15(7-5-14)23-9-2-1-3-10-23/h4-8,11,13H,1-3,9-10,12H2,(H,22,24) |
| InChIKey | BMTIMLNXLASSMP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|