C19H18ClN5O3S — CID 1405221
methyl 4-chloro-2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate (PubChem CID 1405221) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is methyl 4-chloro-2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 1405221 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | methyl 4-chloro-2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCc1ccc(-n2nnnc2SCC(=O)Nc2cc(Cl)ccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C19H18ClN5O3S/c1-3-12-4-7-14(8-5-12)25-19(22-23-24-25)29-11-17(26)21-16-10-13(20)6-9-15(16)18(27)28-2/h4-10H,3,11H2,1-2H3,(H,21,26) |
| InChIKey | STXOGTCGDZZRIE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |