C19H18Cl2N6O2S — CID 4263706
N-(5-chloro-2-morpholin-4-ylphenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 4263706) has the molecular formula C19H18Cl2N6O2S and a molecular weight of 465.37 g/mol. Its IUPAC name is N-(5-chloro-2-morpholin-4-ylphenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4263706 |
| Molecular Formula | C19H18Cl2N6O2S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H18Cl2N6O2S/c20-13-1-4-15(5-2-13)27-19(23-24-25-27)30-12-18(28)22-16-11-14(21)3-6-17(16)26-7-9-29-10-8-26/h1-6,11H,7-10,12H2,(H,22,28) |
| InChIKey | NTIPXKOOZUKWKY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |