C17H23ClN6O2S — CID 8684087
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide (PubChem CID 8684087) has the molecular formula C17H23ClN6O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 8684087 |
| Molecular Formula | C17H23ClN6O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-2-morpholin-4-ylpropyl)acetamide |
| SMILES | CC(C)(CNC(=O)CSc1nnnn1-c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H23ClN6O2S/c1-17(2,23-7-9-26-10-8-23)12-19-15(25)11-27-16-20-21-22-24(16)14-5-3-13(18)4-6-14/h3-6H,7-12H2,1-2H3,(H,19,25) |
| InChIKey | LTVWABRMFFQRPF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |