C14H16ClN5O2S — CID 2610421
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 2610421) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 2610421 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H16ClN5O2S/c15-10-3-5-11(6-4-10)20-14(17-18-19-20)23-9-13(21)16-8-12-2-1-7-22-12/h3-6,12H,1-2,7-9H2,(H,16,21)/t12-/m1/s1 |
| InChIKey | KWQIZDLXNFTXPA-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |