C15H11F2N5OS — CID 705223
N-(2,6-difluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 705223) has the molecular formula C15H11F2N5OS and a molecular weight of 347.35 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 705223 |
| Molecular Formula | C15H11F2N5OS |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H11F2N5OS/c16-11-7-4-8-12(17)14(11)18-13(23)9-24-15-19-20-21-22(15)10-5-2-1-3-6-10/h1-8H,9H2,(H,18,23) |
| InChIKey | JNXBWOFEIMJSBM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |