C21H21ClN6O2S — CID 16535735
2-[[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-cyclopentylbenzamide (PubChem CID 16535735) has the molecular formula C21H21ClN6O2S and a molecular weight of 456.96 g/mol. Its IUPAC name is 2-[[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-cyclopentylbenzamide.
| Compound Name | 2-[[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 16535735 |
| Molecular Formula | C21H21ClN6O2S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-N-cyclopentylbenzamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C21H21ClN6O2S/c22-14-9-11-16(12-10-14)28-21(25-26-27-28)31-13-19(29)24-18-8-4-3-7-17(18)20(30)23-15-5-1-2-6-15/h3-4,7-12,15H,1-2,5-6,13H2,(H,23,30)(H,24,29) |
| InChIKey | PUERUQDYYPMJIF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |