C13H14FN5OS — CID 7562963
(2S)-N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 7562963) has the molecular formula C13H14FN5OS and a molecular weight of 307.35 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7562963 |
| Molecular Formula | C13H14FN5OS |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | C[C@H](Sc1nnnn1-c1cccc(F)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H14FN5OS/c1-8(12(20)15-10-5-6-10)21-13-16-17-18-19(13)11-4-2-3-9(14)7-11/h2-4,7-8,10H,5-6H2,1H3,(H,15,20)/t8-/m0/s1 |
| InChIKey | UDTMVFJVNLEZIX-QMMMGPOBSA-N |
| XLogP | 1.56 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |