C18H22FN5OS — CID 7801982
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 7801982) has the molecular formula C18H22FN5OS and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7801982 |
| Molecular Formula | C18H22FN5OS |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | C[C@H](Sc1nnnn1-c1cccc(F)c1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H22FN5OS/c1-13(17(25)20-11-10-14-6-3-2-4-7-14)26-18-21-22-23-24(18)16-9-5-8-15(19)12-16/h5-6,8-9,12-13H,2-4,7,10-11H2,1H3,(H,20,25)/t13-/m0/s1 |
| InChIKey | VKKAABLFUVGPOW-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|