C20H27N5OS — CID 8797859
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 8797859) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 8797859 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1cccc(-n2nnnc2S[C@H](C)C(=O)NCCC2=CCCCC2)c1C |
| InChI | InChI=1S/C20H27N5OS/c1-14-8-7-11-18(15(14)2)25-20(22-23-24-25)27-16(3)19(26)21-13-12-17-9-5-4-6-10-17/h7-9,11,16H,4-6,10,12-13H2,1-3H3,(H,21,26)/t16-/m1/s1 |
| InChIKey | MZLLYIWCEDEPGX-MRXNPFEDSA-N |
| XLogP | 3.77 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|