C23H30FN5O2S — CID 60604436
N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 60604436) has the molecular formula C23H30FN5O2S and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 60604436 |
| Molecular Formula | C23H30FN5O2S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(N2CCOCC2)n1-c1cccc(F)c1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H30FN5O2S/c1-17(21(30)25-11-10-18-6-3-2-4-7-18)32-23-27-26-22(28-12-14-31-15-13-28)29(23)20-9-5-8-19(24)16-20/h5-6,8-9,16-17H,2-4,7,10-15H2,1H3,(H,25,30) |
| InChIKey | YCPFSALXQXULPK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|