C13H18BrNO2 — CID 107583294
methyl 3-(3-bromo-5-methylanilino)-2,2-dimethylpropanoate (PubChem CID 107583294) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is methyl 3-(3-bromo-5-methylanilino)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(3-bromo-5-methylanilino)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 107583294 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 3-(3-bromo-5-methylanilino)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CNc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2/c1-9-5-10(14)7-11(6-9)15-8-13(2,3)12(16)17-4/h5-7,15H,8H2,1-4H3 |
| InChIKey | CRYFURSKFQZXDU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |