C13H18ClNO3 — CID 113434986
5-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzamide (PubChem CID 113434986) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 5-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzamide.
| Compound Name | 5-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 113434986 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzamide |
| SMILES | CCC(CO)(CO)NC(=O)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C13H18ClNO3/c1-3-13(7-16,8-17)15-12(18)11-6-10(14)5-4-9(11)2/h4-6,16-17H,3,7-8H2,1-2H3,(H,15,18) |
| InChIKey | HHMMTKUNRKHIIL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |