C12H14Br2FNO — CID 107868190
N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-fluorobenzamide (PubChem CID 107868190) has the molecular formula C12H14Br2FNO and a molecular weight of 367.06 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 107868190 |
| Molecular Formula | C12H14Br2FNO |
| Molecular Weight | 367.06 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2-fluorobenzamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C12H14Br2FNO/c1-2-12(7-13,8-14)16-11(17)9-5-3-4-6-10(9)15/h3-6H,2,7-8H2,1H3,(H,16,17) |
| InChIKey | XLJLLGGCKZCZQN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.06 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|