C13H20N2O2 — CID 115365709
N-(3-amino-2,2-dimethylpropyl)-2-hydroxy-4-methylbenzamide (PubChem CID 115365709) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-hydroxy-4-methylbenzamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 115365709 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(C)(C)CN)c(O)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-9-4-5-10(11(16)6-9)12(17)15-8-13(2,3)7-14/h4-6,16H,7-8,14H2,1-3H3,(H,15,17) |
| InChIKey | PBWJBAQCZZTGLN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |