C11H12ClNO2 — CID 114617404
5-chloro-2-hydroxy-N-(2-methylprop-2-enyl)benzamide (PubChem CID 114617404) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-(2-methylprop-2-enyl)benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-(2-methylprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 114617404 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 5-chloro-2-hydroxy-N-(2-methylprop-2-enyl)benzamide |
| SMILES | C=C(C)CNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C11H12ClNO2/c1-7(2)6-13-11(15)9-5-8(12)3-4-10(9)14/h3-5,14H,1,6H2,2H3,(H,13,15) |
| InChIKey | PHZOEUIGTQFWCG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|