C17H23ClINO3 — CID 69007999
tert-butyl 1-[2-(5-chloro-2-iodophenoxy)ethyl]pyrrolidine-2-carboxylate (PubChem CID 69007999) has the molecular formula C17H23ClINO3 and a molecular weight of 451.73 g/mol. Its IUPAC name is tert-butyl 1-[2-(5-chloro-2-iodophenoxy)ethyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-[2-(5-chloro-2-iodophenoxy)ethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 69007999 |
| Molecular Formula | C17H23ClINO3 |
| Molecular Weight | 451.73 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | tert-butyl 1-[2-(5-chloro-2-iodophenoxy)ethyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN1CCOc1cc(Cl)ccc1I |
| InChI | InChI=1S/C17H23ClINO3/c1-17(2,3)23-16(21)14-5-4-8-20(14)9-10-22-15-11-12(18)6-7-13(15)19/h6-7,11,14H,4-5,8-10H2,1-3H3 |
| InChIKey | ZZWLITVQQULUMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|