C18H20O5S — CID 10712724
2-hydroxy-2-(3-naphthalen-2-ylpropylsulfanylmethyl)butanedioic acid (PubChem CID 10712724) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-hydroxy-2-(3-naphthalen-2-ylpropylsulfanylmethyl)butanedioic acid.
| Compound Name | 2-hydroxy-2-(3-naphthalen-2-ylpropylsulfanylmethyl)butanedioic acid |
|---|---|
| PubChem CID | 10712724 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-hydroxy-2-(3-naphthalen-2-ylpropylsulfanylmethyl)butanedioic acid |
| SMILES | O=C(O)CC(O)(CSCCCc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C18H20O5S/c19-16(20)11-18(23,17(21)22)12-24-9-3-4-13-7-8-14-5-1-2-6-15(14)10-13/h1-2,5-8,10,23H,3-4,9,11-12H2,(H,19,20)(H,21,22) |
| InChIKey | YXKAJAQKHGSDOH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|