About CID 57459119
CID 57459119 (PubChem CID 57459119) has the molecular formula C13H13
and a molecular weight of 169.25 g/mol.
Molecular Properties
| Compound Name | CID 57459119 |
| PubChem CID | 57459119 |
| Molecular Formula | C13H13 |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | — |
| SMILES | [CH2]CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H13/c1-2-5-11-8-9-12-6-3-4-7-13(12)10-11/h3-4,6-10H,1-2,5H2 |
| InChIKey | ASGJJAAZUZQSBL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 57459119 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57459119?
The IUPAC name of CID 57459119 (CID 57459119) is not available.
What is the SMILES notation for CID 57459119?
The canonical SMILES for CID 57459119 is [CH2]CCc1ccc2ccccc2c1.
What is the InChIKey of CID 57459119?
The InChIKey is ASGJJAAZUZQSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13/c1-2-5-11-8-9-12-6-3-4-7-13(12)10-11/h3-4,6-10H,1-2,5H2.
What are the key properties of CID 57459119?
CID 57459119 has a molecular weight of 169.25 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57459119 is sourced from PubChem (CID 57459119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).