C17H23ClO5S — CID 102000563
(2R)-2-[6-(4-chlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid (PubChem CID 102000563) has the molecular formula C17H23ClO5S and a molecular weight of 374.89 g/mol. Its IUPAC name is (2R)-2-[6-(4-chlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid.
| Compound Name | (2R)-2-[6-(4-chlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 102000563 |
| Molecular Formula | C17H23ClO5S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2R)-2-[6-(4-chlorophenyl)hexylsulfanylmethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)C[C@](O)(CSCCCCCCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C17H23ClO5S/c18-14-8-6-13(7-9-14)5-3-1-2-4-10-24-12-17(23,16(21)22)11-15(19)20/h6-9,23H,1-5,10-12H2,(H,19,20)(H,21,22)/t17-/m0/s1 |
| InChIKey | ISBUGRLVEGVIRZ-KRWDZBQOSA-N |
| XLogP | 3.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|