C13H13F3O5 — CID 132991578
(2R)-2-hydroxy-2-[3-(3,4,5-trifluorophenyl)propyl]butanedioic acid (PubChem CID 132991578) has the molecular formula C13H13F3O5 and a molecular weight of 306.24 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[3-(3,4,5-trifluorophenyl)propyl]butanedioic acid.
| Compound Name | (2R)-2-hydroxy-2-[3-(3,4,5-trifluorophenyl)propyl]butanedioic acid |
|---|---|
| PubChem CID | 132991578 |
| Molecular Formula | C13H13F3O5 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2R)-2-hydroxy-2-[3-(3,4,5-trifluorophenyl)propyl]butanedioic acid |
| SMILES | O=C(O)C[C@](O)(CCCc1cc(F)c(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C13H13F3O5/c14-8-4-7(5-9(15)11(8)16)2-1-3-13(21,12(19)20)6-10(17)18/h4-5,21H,1-3,6H2,(H,17,18)(H,19,20)/t13-/m1/s1 |
| InChIKey | LBMIZSPNORQOHL-CYBMUJFWSA-N |
| XLogP | 1.72 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|