C9H9F3N2O2 — CID 129317743
2,2-diamino-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 129317743) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 2,2-diamino-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 2,2-diamino-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 129317743 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2,2-diamino-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | NC(N)(Cc1cc(F)c(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C9H9F3N2O2/c10-5-1-4(2-6(11)7(5)12)3-9(13,14)8(15)16/h1-2H,3,13-14H2,(H,15,16) |
| InChIKey | VJPOQTYJTJJFPL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|