C15H14O13 — CID 155433309
benzene-1,3,5-tricarboxylic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 155433309) has the molecular formula C15H14O13 and a molecular weight of 402.26 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | benzene-1,3,5-tricarboxylic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 155433309 |
| Molecular Formula | C15H14O13 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.C6H8O7/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-3H,(H,10,11)(H,12,13)(H,14,15);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | DTOASJAGSWQJPD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 244.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |