C18H26Cl2O5 — CID 57320867
(2R,4S)-10-(2,4-dichlorophenyl)-2,4-dihydroxy-2-[(1R)-1-hydroxyethyl]decanoic acid (PubChem CID 57320867) has the molecular formula C18H26Cl2O5 and a molecular weight of 393.31 g/mol. Its IUPAC name is (2R,4S)-10-(2,4-dichlorophenyl)-2,4-dihydroxy-2-[(1R)-1-hydroxyethyl]decanoic acid.
| Compound Name | (2R,4S)-10-(2,4-dichlorophenyl)-2,4-dihydroxy-2-[(1R)-1-hydroxyethyl]decanoic acid |
|---|---|
| PubChem CID | 57320867 |
| Molecular Formula | C18H26Cl2O5 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2R,4S)-10-(2,4-dichlorophenyl)-2,4-dihydroxy-2-[(1R)-1-hydroxyethyl]decanoic acid |
| SMILES | C[C@@H](O)[C@](O)(C[C@@H](O)CCCCCCc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C18H26Cl2O5/c1-12(21)18(25,17(23)24)11-15(22)7-5-3-2-4-6-13-8-9-14(19)10-16(13)20/h8-10,12,15,21-22,25H,2-7,11H2,1H3,(H,23,24)/t12-,15+,18-/m1/s1 |
| InChIKey | WNAVLQSPGAFVEQ-HNJNHCNJSA-N |
| XLogP | 3.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|