C26H31Cl3O6 — CID 10792660
dimethyl 2-[8-[4-chloro-2-(2,4-dichlorophenyl)phenyl]-2-hydroxyoctyl]-2-hydroxybutanedioate (PubChem CID 10792660) has the molecular formula C26H31Cl3O6 and a molecular weight of 545.89 g/mol. Its IUPAC name is dimethyl 2-[8-[4-chloro-2-(2,4-dichlorophenyl)phenyl]-2-hydroxyoctyl]-2-hydroxybutanedioate.
| Compound Name | dimethyl 2-[8-[4-chloro-2-(2,4-dichlorophenyl)phenyl]-2-hydroxyoctyl]-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 10792660 |
| Molecular Formula | C26H31Cl3O6 |
| Molecular Weight | 545.89 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | dimethyl 2-[8-[4-chloro-2-(2,4-dichlorophenyl)phenyl]-2-hydroxyoctyl]-2-hydroxybutanedioate |
| SMILES | COC(=O)CC(O)(CC(O)CCCCCCc1ccc(Cl)cc1-c1ccc(Cl)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C26H31Cl3O6/c1-34-24(31)16-26(33,25(32)35-2)15-20(30)8-6-4-3-5-7-17-9-10-18(27)13-22(17)21-12-11-19(28)14-23(21)29/h9-14,20,30,33H,3-8,15-16H2,1-2H3 |
| InChIKey | YURRNBNANPMMPN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.89 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|