C18H18Cl3NO2 — CID 58957005
methyl 5-(4-chloroanilino)-5-(2,4-dichlorophenyl)pentanoate (PubChem CID 58957005) has the molecular formula C18H18Cl3NO2 and a molecular weight of 386.71 g/mol. Its IUPAC name is methyl 5-(4-chloroanilino)-5-(2,4-dichlorophenyl)pentanoate.
| Compound Name | methyl 5-(4-chloroanilino)-5-(2,4-dichlorophenyl)pentanoate |
|---|---|
| PubChem CID | 58957005 |
| Molecular Formula | C18H18Cl3NO2 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | methyl 5-(4-chloroanilino)-5-(2,4-dichlorophenyl)pentanoate |
| SMILES | COC(=O)CCCC(Nc1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl3NO2/c1-24-18(23)4-2-3-17(15-10-7-13(20)11-16(15)21)22-14-8-5-12(19)6-9-14/h5-11,17,22H,2-4H2,1H3 |
| InChIKey | UGPNEWABEBEOND-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |