C21H30Cl2O6 — CID 10647166
dimethyl (2R)-2-[(1S)-9-(2,4-dichlorophenyl)-1-hydroxynonyl]-2-hydroxybutanedioate (PubChem CID 10647166) has the molecular formula C21H30Cl2O6 and a molecular weight of 449.37 g/mol. Its IUPAC name is dimethyl (2R)-2-[(1S)-9-(2,4-dichlorophenyl)-1-hydroxynonyl]-2-hydroxybutanedioate.
| Compound Name | dimethyl (2R)-2-[(1S)-9-(2,4-dichlorophenyl)-1-hydroxynonyl]-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 10647166 |
| Molecular Formula | C21H30Cl2O6 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | dimethyl (2R)-2-[(1S)-9-(2,4-dichlorophenyl)-1-hydroxynonyl]-2-hydroxybutanedioate |
| SMILES | COC(=O)C[C@](O)(C(=O)OC)[C@@H](O)CCCCCCCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H30Cl2O6/c1-28-19(25)14-21(27,20(26)29-2)18(24)10-8-6-4-3-5-7-9-15-11-12-16(22)13-17(15)23/h11-13,18,24,27H,3-10,14H2,1-2H3/t18-,21+/m0/s1 |
| InChIKey | ACGFJUULCAJUDO-GHTZIAJQSA-N |
| XLogP | 4.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|